C20H19ClF3N3O2 — CID 89480213
[(7R,8aR)-7-[(5-chloro-2-pyridinyl)oxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 89480213) has the molecular formula C20H19ClF3N3O2 and a molecular weight of 425.84 g/mol. Its IUPAC name is [(7R,8aR)-7-[(5-chloro-2-pyridinyl)oxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(7R,8aR)-7-[(5-chloro-2-pyridinyl)oxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 89480213 |
| Molecular Formula | C20H19ClF3N3O2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [(7R,8aR)-7-[(5-chloro-2-pyridinyl)oxy]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN2C[C@H](Oc3ccc(Cl)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H19ClF3N3O2/c21-15-4-5-18(25-10-15)29-17-9-16-11-27(7-6-26(16)12-17)19(28)13-2-1-3-14(8-13)20(22,23)24/h1-5,8,10,16-17H,6-7,9,11-12H2/t16-,17-/m1/s1 |
| InChIKey | WEGOKPROAQJUOB-IAGOWNOFSA-N |
| XLogP | 3.73 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |