About 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate
2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate (PubChem CID 89466456) has the molecular formula C25H26O3
and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate |
| PubChem CID | 89466456 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)c1ccc2ccccc2c1.C=Cc1ccccc1O |
| InChI | InChI=1S/C17H18O2.C8H8O/c1-12(2)16(18)19-17(3,4)15-10-9-13-7-5-6-8-14(13)11-15;1-2-7-5-3-4-6-8(7)9/h5-11H,1H2,2-4H3;2-6,9H,1H2 |
| InChIKey | JDGNSSPWEFVXJT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate?
The IUPAC name of 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate (CID 89466456) is 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate.
What is the SMILES notation for 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate?
The canonical SMILES for 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)(C)c1ccc2ccccc2c1.C=Cc1ccccc1O.
What is the InChIKey of 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate?
The InChIKey is JDGNSSPWEFVXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2.C8H8O/c1-12(2)16(18)19-17(3,4)15-10-9-13-7-5-6-8-14(13)11-15;1-2-7-5-3-4-6-8(7)9/h5-11H,1H2,2-4H3;2-6,9H,1H2.
What are the key properties of 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate?
2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate has a molecular weight of 374.48 g/mol, XLogP of 6.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylphenol;2-naphthalen-2-ylpropan-2-yl 2-methylprop-2-enoate is sourced from PubChem (CID 89466456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).