C20H26N4O5 — CID 8946697
[2-(butylcarbamoylamino)-2-oxoethyl] 3-(2-methylpropyl)-4-oxophthalazine-1-carboxylate (PubChem CID 8946697) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 3-(2-methylpropyl)-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-(2-methylpropyl)-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8946697 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 3-(2-methylpropyl)-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)c1nn(CC(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H26N4O5/c1-4-5-10-21-20(28)22-16(25)12-29-19(27)17-14-8-6-7-9-15(14)18(26)24(23-17)11-13(2)3/h6-9,13H,4-5,10-12H2,1-3H3,(H2,21,22,25,28) |
| InChIKey | DOTYUXVKIJWQHE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|