C17H18FN5O — CID 89467060
1-[4-(3-amino-1,2-dihydroimidazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 89467060) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-[4-(3-amino-1,2-dihydroimidazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-(3-amino-1,2-dihydroimidazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 89467060 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-[4-(3-amino-1,2-dihydroimidazol-4-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(C3=CNCN3N)cc2)c1 |
| InChI | InChI=1S/C17H18FN5O/c1-11-2-7-14(18)15(8-11)22-17(24)21-13-5-3-12(4-6-13)16-9-20-10-23(16)19/h2-9,20H,10,19H2,1H3,(H2,21,22,24) |
| InChIKey | BXKZGYPZLLXYLR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|