C30H34Cl2N6OS2 — CID 89467075
5-[5-(2-cyclopentylethynyl)thiophen-2-yl]-1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 89467075) has the molecular formula C30H34Cl2N6OS2 and a molecular weight of 629.68 g/mol. Its IUPAC name is 5-[5-(2-cyclopentylethynyl)thiophen-2-yl]-1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 5-[5-(2-cyclopentylethynyl)thiophen-2-yl]-1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 89467075 |
| Molecular Formula | C30H34Cl2N6OS2 |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | 5-[5-(2-cyclopentylethynyl)thiophen-2-yl]-1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | CCNC(=S)NCc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CC2CCCC2)s1 |
| InChI | InChI=1S/C30H34Cl2N6OS2/c1-2-33-30(40)34-19-23-27(29(39)36-37-16-6-3-7-17-37)35-38(25-14-11-21(31)18-24(25)32)28(23)26-15-13-22(41-26)12-10-20-8-4-5-9-20/h11,13-15,18,20H,2-9,16-17,19H2,1H3,(H,36,39)(H2,33,34,40) |
| InChIKey | IFIAPRJWQBIKOV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|