C28H32Cl2N6OS2 — CID 89474572
1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-5-(5-pent-1-ynylthiophen-2-yl)-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 89474572) has the molecular formula C28H32Cl2N6OS2 and a molecular weight of 603.65 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-5-(5-pent-1-ynylthiophen-2-yl)-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-5-(5-pent-1-ynylthiophen-2-yl)-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 89474572 |
| Molecular Formula | C28H32Cl2N6OS2 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-[(ethylcarbamothioylamino)methyl]-5-(5-pent-1-ynylthiophen-2-yl)-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | CCCC#Cc1ccc(-c2c(CNC(=S)NCC)c(C(=O)NN3CCCCC3)nn2-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C28H32Cl2N6OS2/c1-3-5-7-10-20-12-14-24(39-20)26-21(18-32-28(38)31-4-2)25(27(37)34-35-15-8-6-9-16-35)33-36(26)23-13-11-19(29)17-22(23)30/h11-14,17H,3-6,8-9,15-16,18H2,1-2H3,(H,34,37)(H2,31,32,38) |
| InChIKey | PJDMMCAVJNUKAF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|