C19H12ClF3IN — CID 89467100
N-[[2-chloro-5-(3-fluorophenyl)phenyl]methyl]-2,6-difluoro-3-iodoaniline (PubChem CID 89467100) has the molecular formula C19H12ClF3IN and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[[2-chloro-5-(3-fluorophenyl)phenyl]methyl]-2,6-difluoro-3-iodoaniline.
| Compound Name | N-[[2-chloro-5-(3-fluorophenyl)phenyl]methyl]-2,6-difluoro-3-iodoaniline |
|---|---|
| PubChem CID | 89467100 |
| Molecular Formula | C19H12ClF3IN |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | N-[[2-chloro-5-(3-fluorophenyl)phenyl]methyl]-2,6-difluoro-3-iodoaniline |
| SMILES | Fc1cccc(-c2ccc(Cl)c(CNc3c(F)ccc(I)c3F)c2)c1 |
| InChI | InChI=1S/C19H12ClF3IN/c20-15-5-4-12(11-2-1-3-14(21)9-11)8-13(15)10-25-19-16(22)6-7-17(24)18(19)23/h1-9,25H,10H2 |
| InChIKey | WMMXOAGWYGQURF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|