C18H44O2Si3 — CID 89467391
butan-2-yl-[1-[hydroxy-methyl-(2-trimethylsilyloxybutan-2-yl)silyl]butan-2-yl]-dimethylsilane (PubChem CID 89467391) has the molecular formula C18H44O2Si3 and a molecular weight of 376.81 g/mol. Its IUPAC name is butan-2-yl-[1-[hydroxy-methyl-(2-trimethylsilyloxybutan-2-yl)silyl]butan-2-yl]-dimethylsilane.
| Compound Name | butan-2-yl-[1-[hydroxy-methyl-(2-trimethylsilyloxybutan-2-yl)silyl]butan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 89467391 |
| Molecular Formula | C18H44O2Si3 |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | butan-2-yl-[1-[hydroxy-methyl-(2-trimethylsilyloxybutan-2-yl)silyl]butan-2-yl]-dimethylsilane |
| SMILES | CCC(C)[Si](C)(C)C(CC)C[Si](C)(O)C(C)(CC)O[Si](C)(C)C |
| InChI | InChI=1S/C18H44O2Si3/c1-12-16(4)22(9,10)17(13-2)15-23(11,19)18(5,14-3)20-21(6,7)8/h16-17,19H,12-15H2,1-11H3 |
| InChIKey | VFUVTKROLNELIG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|