C17H11Br2IO — CID 89468148
(3-benzyl-1,6-dibromonaphthalen-2-yl) hypoiodite (PubChem CID 89468148) has the molecular formula C17H11Br2IO and a molecular weight of 517.99 g/mol. Its IUPAC name is (3-benzyl-1,6-dibromonaphthalen-2-yl) hypoiodite.
| Compound Name | (3-benzyl-1,6-dibromonaphthalen-2-yl) hypoiodite |
|---|---|
| PubChem CID | 89468148 |
| Molecular Formula | C17H11Br2IO |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 515.82 |
| IUPAC Name | (3-benzyl-1,6-dibromonaphthalen-2-yl) hypoiodite |
| SMILES | Brc1ccc2c(Br)c(OI)c(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C17H11Br2IO/c18-14-6-7-15-12(10-14)9-13(17(21-20)16(15)19)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2 |
| InChIKey | GGSOEZNSAIYEDJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|