C28H25BrO4 — CID 142679051
methyl 2-(3,6-dibenzyl-1-bromo-7-methoxynaphthalen-2-yl)oxyacetate (PubChem CID 142679051) has the molecular formula C28H25BrO4 and a molecular weight of 505.41 g/mol. Its IUPAC name is methyl 2-(3,6-dibenzyl-1-bromo-7-methoxynaphthalen-2-yl)oxyacetate.
| Compound Name | methyl 2-(3,6-dibenzyl-1-bromo-7-methoxynaphthalen-2-yl)oxyacetate |
|---|---|
| PubChem CID | 142679051 |
| Molecular Formula | C28H25BrO4 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | methyl 2-(3,6-dibenzyl-1-bromo-7-methoxynaphthalen-2-yl)oxyacetate |
| SMILES | COC(=O)COc1c(Cc2ccccc2)cc2cc(Cc3ccccc3)c(OC)cc2c1Br |
| InChI | InChI=1S/C28H25BrO4/c1-31-25-17-24-21(15-22(25)13-19-9-5-3-6-10-19)16-23(14-20-11-7-4-8-12-20)28(27(24)29)33-18-26(30)32-2/h3-12,15-17H,13-14,18H2,1-2H3 |
| InChIKey | GHCYGCTWZNHNHO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |