C9H11N3S — CID 89468371
4-amino-5-methyl-4a,8a-dihydro-1H-quinazoline-2-thione (PubChem CID 89468371) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 4-amino-5-methyl-4a,8a-dihydro-1H-quinazoline-2-thione.
| Compound Name | 4-amino-5-methyl-4a,8a-dihydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 89468371 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-amino-5-methyl-4a,8a-dihydro-1H-quinazoline-2-thione |
| SMILES | CC1=CC=CC2NC(=S)N=C(N)C12 |
| InChI | InChI=1S/C9H11N3S/c1-5-3-2-4-6-7(5)8(10)12-9(13)11-6/h2-4,6-7H,1H3,(H3,10,11,12,13) |
| InChIKey | RBVRNRDHOBRHRZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|