C22H31N5O5 — CID 89471952
tert-butyl (1R,3S,4S)-3-[[(2S)-1-amino-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 89471952) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S)-3-[[(2S)-1-amino-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S)-3-[[(2S)-1-amino-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89471952 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl (1R,3S,4S)-3-[[(2S)-1-amino-3-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-1-oxopropan-2-yl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)N[C@@H](Cc1ccc(/C(N)=N/O)cc1)C(N)=O |
| InChI | InChI=1S/C22H31N5O5/c1-22(2,3)32-21(30)27-15-9-8-14(11-15)17(27)20(29)25-16(19(24)28)10-12-4-6-13(7-5-12)18(23)26-31/h4-7,14-17,31H,8-11H2,1-3H3,(H2,23,26)(H2,24,28)(H,25,29)/t14-,15+,16-,17-/m0/s1 |
| InChIKey | LYMFWSNBHOITKW-YVSFHVDLSA-N |
| XLogP | 1.08 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|