C27H33N3O5 — CID 123817688
tert-butyl 3-[[1-amino-2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 123817688) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is tert-butyl 3-[[1-amino-2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-[[1-amino-2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123817688 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | tert-butyl 3-[[1-amino-2-[4-(1,3-benzodioxol-5-yl)phenyl]ethyl]carbamoyl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(C2)C1C(=O)NC(N)Cc1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H33N3O5/c1-27(2,3)35-26(32)30-20-10-8-19(13-20)24(30)25(31)29-23(28)12-16-4-6-17(7-5-16)18-9-11-21-22(14-18)34-15-33-21/h4-7,9,11,14,19-20,23-24H,8,10,12-13,15,28H2,1-3H3,(H,29,31) |
| InChIKey | KURANBYJOCQSNX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|