C17H19F3O2 — CID 89475133
[1-propan-2-yl-6-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate (PubChem CID 89475133) has the molecular formula C17H19F3O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is [1-propan-2-yl-6-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate.
| Compound Name | [1-propan-2-yl-6-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89475133 |
| Molecular Formula | C17H19F3O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [1-propan-2-yl-6-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(C)C)CCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H19F3O2/c1-10(2)15(21)22-16(11(3)4)8-7-12-5-6-13(9-14(12)16)17(18,19)20/h5-6,9,11H,1,7-8H2,2-4H3 |
| InChIKey | JWIROMICJFHVRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|