C27H15F4N3O2 — CID 89477903
(3-pyridin-3-ylquinoxalin-6-yl)-[2,3,6-trifluoro-5-[(3-fluorophenyl)methoxy]phenyl]methanone (PubChem CID 89477903) has the molecular formula C27H15F4N3O2 and a molecular weight of 489.43 g/mol. Its IUPAC name is (3-pyridin-3-ylquinoxalin-6-yl)-[2,3,6-trifluoro-5-[(3-fluorophenyl)methoxy]phenyl]methanone.
| Compound Name | (3-pyridin-3-ylquinoxalin-6-yl)-[2,3,6-trifluoro-5-[(3-fluorophenyl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 89477903 |
| Molecular Formula | C27H15F4N3O2 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | (3-pyridin-3-ylquinoxalin-6-yl)-[2,3,6-trifluoro-5-[(3-fluorophenyl)methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc2ncc(-c3cccnc3)nc2c1)c1c(F)c(F)cc(OCc2cccc(F)c2)c1F |
| InChI | InChI=1S/C27H15F4N3O2/c28-18-5-1-3-15(9-18)14-36-23-11-19(29)25(30)24(26(23)31)27(35)16-6-7-20-21(10-16)34-22(13-33-20)17-4-2-8-32-12-17/h1-13H,14H2 |
| InChIKey | OFPTYNYPBGYLQM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|