C13H8F3N3O2 — CID 89480540
7-pyrimidin-5-yl-3-(2,2,2-trifluoroethoxy)-1,2-benzoxazole (PubChem CID 89480540) has the molecular formula C13H8F3N3O2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 7-pyrimidin-5-yl-3-(2,2,2-trifluoroethoxy)-1,2-benzoxazole.
| Compound Name | 7-pyrimidin-5-yl-3-(2,2,2-trifluoroethoxy)-1,2-benzoxazole |
|---|---|
| PubChem CID | 89480540 |
| Molecular Formula | C13H8F3N3O2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 7-pyrimidin-5-yl-3-(2,2,2-trifluoroethoxy)-1,2-benzoxazole |
| SMILES | FC(F)(F)COc1noc2c(-c3cncnc3)cccc12 |
| InChI | InChI=1S/C13H8F3N3O2/c14-13(15,16)6-20-12-10-3-1-2-9(11(10)21-19-12)8-4-17-7-18-5-8/h1-5,7H,6H2 |
| InChIKey | CFOFHRAGHIPYHT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |