C17H19N5O5 — CID 89480938
(4-nitrophenyl) 4-[(4-carbamoylpyrazol-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 89480938) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[(4-carbamoylpyrazol-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-[(4-carbamoylpyrazol-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89480938 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (4-nitrophenyl) 4-[(4-carbamoylpyrazol-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | NC(=O)c1cnn(CC2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C17H19N5O5/c18-16(23)13-9-19-21(11-13)10-12-5-7-20(8-6-12)17(24)27-15-3-1-14(2-4-15)22(25)26/h1-4,9,11-12H,5-8,10H2,(H2,18,23) |
| InChIKey | QBUPMCKEDKOMMV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|