C28H39N3O4S — CID 89482238
4-phenylmethoxy-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide (PubChem CID 89482238) has the molecular formula C28H39N3O4S and a molecular weight of 513.70 g/mol. Its IUPAC name is 4-phenylmethoxy-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide.
| Compound Name | 4-phenylmethoxy-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 89482238 |
| Molecular Formula | C28H39N3O4S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 4-phenylmethoxy-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide |
| SMILES | CCCS(=O)(=O)N1CCN(C2(CNC(=O)c3ccc(OCc4ccccc4)cc3)CCCCC2)CC1 |
| InChI | InChI=1S/C28H39N3O4S/c1-2-21-36(33,34)31-19-17-30(18-20-31)28(15-7-4-8-16-28)23-29-27(32)25-11-13-26(14-12-25)35-22-24-9-5-3-6-10-24/h3,5-6,9-14H,2,4,7-8,15-23H2,1H3,(H,29,32) |
| InChIKey | POYBOJOBVAMLHM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |