C22H35N3O3S2 — CID 123313384
N-methylsulfanyl-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide (PubChem CID 123313384) has the molecular formula C22H35N3O3S2 and a molecular weight of 453.67 g/mol. Its IUPAC name is N-methylsulfanyl-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide.
| Compound Name | N-methylsulfanyl-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 123313384 |
| Molecular Formula | C22H35N3O3S2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-methylsulfanyl-N-[[1-(4-propylsulfonylpiperazin-1-yl)cyclohexyl]methyl]benzamide |
| SMILES | CCCS(=O)(=O)N1CCN(C2(CN(SC)C(=O)c3ccccc3)CCCCC2)CC1 |
| InChI | InChI=1S/C22H35N3O3S2/c1-3-18-30(27,28)24-16-14-23(15-17-24)22(12-8-5-9-13-22)19-25(29-2)21(26)20-10-6-4-7-11-20/h4,6-7,10-11H,3,5,8-9,12-19H2,1-2H3 |
| InChIKey | USVAPRDPGDVEFX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|