C20H32N4O5 — CID 89482414
2-[2-[2-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propylamino]-2-oxoethoxy]ethoxy]ethylcarbamic acid (PubChem CID 89482414) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[2-[2-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propylamino]-2-oxoethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propylamino]-2-oxoethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 89482414 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-[2-[2-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propylamino]-2-oxoethoxy]ethoxy]ethylcarbamic acid |
| SMILES | CN1CCC[C@H]1c1cncc(CCCNC(=O)COCCOCCNC(=O)O)c1 |
| InChI | InChI=1S/C20H32N4O5/c1-24-8-3-5-18(24)17-12-16(13-21-14-17)4-2-6-22-19(25)15-29-11-10-28-9-7-23-20(26)27/h12-14,18,23H,2-11,15H2,1H3,(H,22,25)(H,26,27)/t18-/m0/s1 |
| InChIKey | QZQVLGHMZNGXMR-SFHVURJKSA-N |
| XLogP | 1.20 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|