C18H17BrFNO4 — CID 89482923
benzyl N-[5-bromo-4-fluoro-2-[(Z)-4-hydroxybut-2-enoxy]phenyl]carbamate (PubChem CID 89482923) has the molecular formula C18H17BrFNO4 and a molecular weight of 410.24 g/mol. Its IUPAC name is benzyl N-[5-bromo-4-fluoro-2-[(Z)-4-hydroxybut-2-enoxy]phenyl]carbamate.
| Compound Name | benzyl N-[5-bromo-4-fluoro-2-[(Z)-4-hydroxybut-2-enoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 89482923 |
| Molecular Formula | C18H17BrFNO4 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | benzyl N-[5-bromo-4-fluoro-2-[(Z)-4-hydroxybut-2-enoxy]phenyl]carbamate |
| SMILES | O=C(Nc1cc(Br)c(F)cc1OC/C=C\CO)OCc1ccccc1 |
| InChI | InChI=1S/C18H17BrFNO4/c19-14-10-16(17(11-15(14)20)24-9-5-4-8-22)21-18(23)25-12-13-6-2-1-3-7-13/h1-7,10-11,22H,8-9,12H2,(H,21,23)/b5-4- |
| InChIKey | UVGCGPYZBNTVHV-PLNGDYQASA-N |
| XLogP | 4.26 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|