C17H15F2NO3 — CID 69422302
benzyl N-[2,6-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate (PubChem CID 69422302) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is benzyl N-[2,6-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate.
| Compound Name | benzyl N-[2,6-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69422302 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | benzyl N-[2,6-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate |
| SMILES | O=C(Nc1c(F)cc(/C=C/CO)cc1F)OCc1ccccc1 |
| InChI | InChI=1S/C17H15F2NO3/c18-14-9-13(7-4-8-21)10-15(19)16(14)20-17(22)23-11-12-5-2-1-3-6-12/h1-7,9-10,21H,8,11H2,(H,20,22)/b7-4+ |
| InChIKey | KGZRVMURNUEZHZ-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |