About 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid
3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid (PubChem CID 89483012) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid.
Molecular Properties
| Compound Name | 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid |
| PubChem CID | 89483012 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid |
| SMILES | N#CCC(=O)C1CCCCN1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H12N2O.C8H8O2/c9-5-4-8(11)7-3-1-2-6-10-7;9-8(10)6-7-4-2-1-3-5-7/h7,10H,1-4,6H2;1-5H,6H2,(H,9,10) |
| InChIKey | AURLMYUMOSNKNP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid?
The IUPAC name of 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid (CID 89483012) is 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid.
What is the SMILES notation for 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid?
The canonical SMILES for 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid is N#CCC(=O)C1CCCCN1.O=C(O)Cc1ccccc1.
What is the InChIKey of 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid?
The InChIKey is AURLMYUMOSNKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O.C8H8O2/c9-5-4-8(11)7-3-1-2-6-10-7;9-8(10)6-7-4-2-1-3-5-7/h7,10H,1-4,6H2;1-5H,6H2,(H,9,10).
What are the key properties of 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid?
3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid has a molecular weight of 288.35 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-piperidin-2-ylpropanenitrile;2-phenylacetic acid is sourced from PubChem (CID 89483012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).