C21H29N9O2 — CID 89484694
3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[1-(2-ethoxyethyl)indazol-4-yl]amino]-1,2,4-triazine-6-carboxamide (PubChem CID 89484694) has the molecular formula C21H29N9O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[1-(2-ethoxyethyl)indazol-4-yl]amino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[1-(2-ethoxyethyl)indazol-4-yl]amino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 89484694 |
| Molecular Formula | C21H29N9O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3-[[(1R,2S)-2-aminocyclohexyl]amino]-5-[[1-(2-ethoxyethyl)indazol-4-yl]amino]-1,2,4-triazine-6-carboxamide |
| SMILES | CCOCCn1ncc2c(Nc3nc(N[C@@H]4CCCC[C@@H]4N)nnc3C(N)=O)cccc21 |
| InChI | InChI=1S/C21H29N9O2/c1-2-32-11-10-30-17-9-5-8-15(13(17)12-24-30)25-20-18(19(23)31)28-29-21(27-20)26-16-7-4-3-6-14(16)22/h5,8-9,12,14,16H,2-4,6-7,10-11,22H2,1H3,(H2,23,31)(H2,25,26,27,29)/t14-,16+/m0/s1 |
| InChIKey | GCIBQXPKDNNGQU-GOEBONIOSA-N |
| XLogP | 1.78 |
| TPSA | 158.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|