C42H36Cl2N4O4 — CID 89487387
7-(3-chlorophenyl)-4-(2-hydroxyethyl)-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one;2-[7-(3-chlorophenyl)-1-oxo-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde (PubChem CID 89487387) has the molecular formula C42H36Cl2N4O4 and a molecular weight of 731.68 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-4-(2-hydroxyethyl)-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one;2-[7-(3-chlorophenyl)-1-oxo-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde.
| Compound Name | 7-(3-chlorophenyl)-4-(2-hydroxyethyl)-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one;2-[7-(3-chlorophenyl)-1-oxo-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89487387 |
| Molecular Formula | C42H36Cl2N4O4 |
| Molecular Weight | 731.68 g/mol |
| Exact Mass | 730.21 |
| IUPAC Name | 7-(3-chlorophenyl)-4-(2-hydroxyethyl)-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one;2-[7-(3-chlorophenyl)-1-oxo-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde |
| SMILES | O=C1NCC(CCO)n2c1cc(-c1cccc(Cl)c1)c2-c1ccccc1.O=CCC1CNC(=O)c2cc(-c3cccc(Cl)c3)c(-c3ccccc3)n21 |
| InChI | InChI=1S/C21H19ClN2O2.C21H17ClN2O2/c2*22-16-8-4-7-15(11-16)18-12-19-21(26)23-13-17(9-10-25)24(19)20(18)14-5-2-1-3-6-14/h1-8,11-12,17,25H,9-10,13H2,(H,23,26);1-8,10-12,17H,9,13H2,(H,23,26) |
| InChIKey | PQVMIPQMECRFRX-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.68 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|