C19H28N4O3 — CID 89488501
[1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclopropylpiperazine-1-carboxylate (PubChem CID 89488501) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclopropylpiperazine-1-carboxylate.
| Compound Name | [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclopropylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89488501 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclopropylpiperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCC(OC(=O)N3CCN(C4CC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C19H28N4O3/c1-25-17-4-5-18(20-14-17)22-8-6-16(7-9-22)26-19(24)23-12-10-21(11-13-23)15-2-3-15/h4-5,14-16H,2-3,6-13H2,1H3 |
| InChIKey | KCDQDBZCBXAPAT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |