C19H21ClF3N5O3 — CID 89489892
3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one (PubChem CID 89489892) has the molecular formula C19H21ClF3N5O3 and a molecular weight of 459.86 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89489892 |
| Molecular Formula | C19H21ClF3N5O3 |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1OC(=O)N(c2ccnc(N[C@@H](C)c3cnc(OCC(F)(F)F)c(Cl)c3)n2)C1(C)C |
| InChI | InChI=1S/C19H21ClF3N5O3/c1-10(12-7-13(20)15(25-8-12)30-9-19(21,22)23)26-16-24-6-5-14(27-16)28-17(29)31-11(2)18(28,3)4/h5-8,10-11H,9H2,1-4H3,(H,24,26,27)/t10-,11?/m0/s1 |
| InChIKey | AWDKKIGCXUEVFC-VUWPPUDQSA-N |
| XLogP | 4.76 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |