C16H24FN3 — CID 89490119
(1S)-1-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-fluorophenyl]ethanamine (PubChem CID 89490119) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is (1S)-1-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-fluorophenyl]ethanamine.
| Compound Name | (1S)-1-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 89490119 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (1S)-1-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-fluorophenyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(CN2CCN3CCCC3C2)c(F)c1 |
| InChI | InChI=1S/C16H24FN3/c1-12(18)13-4-5-14(16(17)9-13)10-19-7-8-20-6-2-3-15(20)11-19/h4-5,9,12,15H,2-3,6-8,10-11,18H2,1H3/t12-,15?/m0/s1 |
| InChIKey | PYGMRJTTXXNXLO-SFVWDYPZSA-N |
| XLogP | 2.13 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |