C19H20BF2N5O2 — CID 89490430
CID 89490430 (PubChem CID 89490430) has the molecular formula C19H20BF2N5O2 and a molecular weight of 399.21 g/mol.
| Compound Name | CID 89490430 |
|---|---|
| PubChem CID | 89490430 |
| Molecular Formula | C19H20BF2N5O2 |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN(Cc2ccc(F)c(NC(=O)Nc3ccc(C)nc3)c2F)CC1 |
| InChI | InChI=1S/C19H20BF2N5O2/c1-12-2-4-14(10-23-12)24-19(29)25-17-15(21)5-3-13(16(17)22)11-26-6-8-27(9-7-26)18(20)28/h2-5,10H,6-9,11H2,1H3,(H2,24,25,29) |
| InChIKey | IHMCWUPRGXMYRL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|