C36H33N3O9 — CID 89491265
2-[2,4,6-trioxo-3,5-bis[2-(3-phenylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-phenylprop-2-enoate (PubChem CID 89491265) has the molecular formula C36H33N3O9 and a molecular weight of 651.67 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis[2-(3-phenylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-phenylprop-2-enoate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis[2-(3-phenylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 89491265 |
| Molecular Formula | C36H33N3O9 |
| Molecular Weight | 651.67 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-(3-phenylprop-2-enoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OCCn1c(=O)n(CCOC(=O)C=Cc2ccccc2)c(=O)n(CCOC(=O)C=Cc2ccccc2)c1=O |
| InChI | InChI=1S/C36H33N3O9/c40-31(19-16-28-10-4-1-5-11-28)46-25-22-37-34(43)38(23-26-47-32(41)20-17-29-12-6-2-7-13-29)36(45)39(35(37)44)24-27-48-33(42)21-18-30-14-8-3-9-15-30/h1-21H,22-27H2 |
| InChIKey | PLKFIKFROJJOEY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|