C20H22N2O2 — CID 89492554
1-[[(1S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]cyclopropane-1-carboxamide (PubChem CID 89492554) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[[(1S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]cyclopropane-1-carboxamide.
| Compound Name | 1-[[(1S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89492554 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[[(1S)-2-(4-phenylmethoxyphenyl)cyclopropyl]amino]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(N[C@H]2CC2c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C20H22N2O2/c21-19(23)20(10-11-20)22-18-12-17(18)15-6-8-16(9-7-15)24-13-14-4-2-1-3-5-14/h1-9,17-18,22H,10-13H2,(H2,21,23)/t17?,18-/m0/s1 |
| InChIKey | VFOXIWWERBHXPW-ZVAWYAOSSA-N |
| XLogP | 2.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |