C17H19N5OS — CID 89494438
3-[5-[(4-methylpiperazin-1-yl)methyl]thiophen-2-yl]imidazo[1,2-b]pyridazine-6-carbaldehyde (PubChem CID 89494438) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-[5-[(4-methylpiperazin-1-yl)methyl]thiophen-2-yl]imidazo[1,2-b]pyridazine-6-carbaldehyde.
| Compound Name | 3-[5-[(4-methylpiperazin-1-yl)methyl]thiophen-2-yl]imidazo[1,2-b]pyridazine-6-carbaldehyde |
|---|---|
| PubChem CID | 89494438 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-[5-[(4-methylpiperazin-1-yl)methyl]thiophen-2-yl]imidazo[1,2-b]pyridazine-6-carbaldehyde |
| SMILES | CN1CCN(Cc2ccc(-c3cnc4ccc(C=O)nn34)s2)CC1 |
| InChI | InChI=1S/C17H19N5OS/c1-20-6-8-21(9-7-20)11-14-3-4-16(24-14)15-10-18-17-5-2-13(12-23)19-22(15)17/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | WUEGXQLSCHMNLW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|