C18H23N5OS — CID 68820661
6-[3-(4-methylpiperazin-1-yl)propoxy]-3-thiophen-2-ylimidazo[1,2-b]pyridazine (PubChem CID 68820661) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-thiophen-2-ylimidazo[1,2-b]pyridazine.
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-thiophen-2-ylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 68820661 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-thiophen-2-ylimidazo[1,2-b]pyridazine |
| SMILES | CN1CCN(CCCOc2ccc3ncc(-c4cccs4)n3n2)CC1 |
| InChI | InChI=1S/C18H23N5OS/c1-21-8-10-22(11-9-21)7-3-12-24-18-6-5-17-19-14-15(23(17)20-18)16-4-2-13-25-16/h2,4-6,13-14H,3,7-12H2,1H3 |
| InChIKey | CZXXIHVEYWZMMC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|