C20H24FN5O — CID 24850546
3-(3-fluorophenyl)-6-[3-(4-methylpiperazin-1-yl)propoxy]imidazo[1,2-b]pyridazine (PubChem CID 24850546) has the molecular formula C20H24FN5O and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-6-[3-(4-methylpiperazin-1-yl)propoxy]imidazo[1,2-b]pyridazine.
| Compound Name | 3-(3-fluorophenyl)-6-[3-(4-methylpiperazin-1-yl)propoxy]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 24850546 |
| Molecular Formula | C20H24FN5O |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 3-(3-fluorophenyl)-6-[3-(4-methylpiperazin-1-yl)propoxy]imidazo[1,2-b]pyridazine |
| SMILES | CN1CCN(CCCOc2ccc3ncc(-c4cccc(F)c4)n3n2)CC1 |
| InChI | InChI=1S/C20H24FN5O/c1-24-9-11-25(12-10-24)8-3-13-27-20-7-6-19-22-15-18(26(19)23-20)16-4-2-5-17(21)14-16/h2,4-7,14-15H,3,8-13H2,1H3 |
| InChIKey | JQBQAJBTVDUNOM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|