C21H24F3N5O2 — CID 24866991
6-[3-(4-methylpiperazin-1-yl)propoxy]-3-[2-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazine (PubChem CID 24866991) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-[2-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazine.
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-[2-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 24866991 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)propoxy]-3-[2-(trifluoromethoxy)phenyl]imidazo[1,2-b]pyridazine |
| SMILES | CN1CCN(CCCOc2ccc3ncc(-c4ccccc4OC(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C21H24F3N5O2/c1-27-10-12-28(13-11-27)9-4-14-30-20-8-7-19-25-15-17(29(19)26-20)16-5-2-3-6-18(16)31-21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChIKey | FCOGLGFCWPYYQU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|