C26H34FN5O4S — CID 89495771
4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 89495771) has the molecular formula C26H34FN5O4S and a molecular weight of 531.65 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89495771 |
| Molecular Formula | C26H34FN5O4S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 4-[2-(butylamino)-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCOCC4)c(F)c3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C26H34FN5O4S/c1-2-3-10-28-26-29-16-21-22(17-32(25(21)30-26)19-5-7-20(33)8-6-19)18-4-9-24(23(27)15-18)37(34,35)31-11-13-36-14-12-31/h4,9,15-17,19-20,33H,2-3,5-8,10-14H2,1H3,(H,28,29,30) |
| InChIKey | VEFDEIILCRXHNC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|