C21H27NO4 — CID 8952145
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 8952145) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 8952145 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)[C@@H](C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C21H27NO4/c1-5-6-14(2)22-20(23)13-26-21(24)15(3)16-7-8-18-12-19(25-4)10-9-17(18)11-16/h7-12,14-15H,5-6,13H2,1-4H3,(H,22,23)/t14-,15-/m0/s1 |
| InChIKey | KRLNGHPKWIWPOY-GJZGRUSLSA-N |
| XLogP | 3.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |