C18H20N2O5 — CID 8952748
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 8952748) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 8952748 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCC(=O)NCC(N)=O)ccc2c1 |
| InChI | InChI=1S/C18H20N2O5/c1-11(18(23)25-10-17(22)20-9-16(19)21)12-3-4-14-8-15(24-2)6-5-13(14)7-12/h3-8,11H,9-10H2,1-2H3,(H2,19,21)(H,20,22)/t11-/m0/s1 |
| InChIKey | LSJSNHYWAYXYSL-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |