C21H21NO5S — CID 8954537
[2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 8954537) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8954537 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylethylamino)ethyl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | COCc1c(C(=O)OCC(=O)NCCSc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C21H21NO5S/c1-25-13-17-16-9-5-6-10-18(16)27-20(17)21(24)26-14-19(23)22-11-12-28-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3,(H,22,23) |
| InChIKey | XAWMRTNMGFNJAZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|