C21H18N4O5 — CID 8956082
2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 8956082) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8956082 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | C[C@@]1(c2ccc3c(c2)OCO3)NC(=O)N(CC(=O)Nc2ccc(CC#N)cc2)C1=O |
| InChI | InChI=1S/C21H18N4O5/c1-21(14-4-7-16-17(10-14)30-12-29-16)19(27)25(20(28)24-21)11-18(26)23-15-5-2-13(3-6-15)8-9-22/h2-7,10H,8,11-12H2,1H3,(H,23,26)(H,24,28)/t21-/m0/s1 |
| InChIKey | XCSTUEMXYAABMY-NRFANRHFSA-N |
| XLogP | 1.89 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|