C21H19N3O7 — CID 92786608
methyl 4-[[2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate (PubChem CID 92786608) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is methyl 4-[[2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92786608 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 4-[[2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)N[C@](C)(c3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O7/c1-21(13-5-8-15-16(9-13)31-11-30-15)19(27)24(20(28)23-21)10-17(25)22-14-6-3-12(4-7-14)18(26)29-2/h3-9H,10-11H2,1-2H3,(H,22,25)(H,23,28)/t21-/m1/s1 |
| InChIKey | MTFCDWAZCZHUJX-OAQYLSRUSA-N |
| XLogP | 1.61 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|