C12H8F4N2O2S — CID 895672
N-[4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 895672) has the molecular formula C12H8F4N2O2S and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 895672 |
| Molecular Formula | C12H8F4N2O2S |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-[4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1c(F)c(F)c(-c2csc(NC(C)=O)n2)c(F)c1F |
| InChI | InChI=1S/C12H8F4N2O2S/c1-4(19)17-12-18-5(3-21-12)6-7(13)9(15)11(20-2)10(16)8(6)14/h3H,1-2H3,(H,17,18,19) |
| InChIKey | QTLUFFGPVQFHIK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|