C19H20N2O6 — CID 8961201
N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-(4-propanoylphenoxy)acetamide (PubChem CID 8961201) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-(4-propanoylphenoxy)acetamide.
| Compound Name | N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
|---|---|
| PubChem CID | 8961201 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-(4-nitrophenyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)NC[C@H](O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H20N2O6/c1-2-17(22)13-5-9-16(10-6-13)27-12-19(24)20-11-18(23)14-3-7-15(8-4-14)21(25)26/h3-10,18,23H,2,11-12H2,1H3,(H,20,24)/t18-/m0/s1 |
| InChIKey | HWXBBDDAHORKRI-SFHVURJKSA-N |
| XLogP | 2.42 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|