C23H31N2O3+ — CID 8796515
[(1S)-1-(4-ethylphenyl)-2-[[2-(4-propanoylphenoxy)acetyl]amino]ethyl]-dimethylazanium (PubChem CID 8796515) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is [(1S)-1-(4-ethylphenyl)-2-[[2-(4-propanoylphenoxy)acetyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(4-ethylphenyl)-2-[[2-(4-propanoylphenoxy)acetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8796515 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [(1S)-1-(4-ethylphenyl)-2-[[2-(4-propanoylphenoxy)acetyl]amino]ethyl]-dimethylazanium |
| SMILES | CCC(=O)c1ccc(OCC(=O)NC[C@H](c2ccc(CC)cc2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-5-17-7-9-18(10-8-17)21(25(3)4)15-24-23(27)16-28-20-13-11-19(12-14-20)22(26)6-2/h7-14,21H,5-6,15-16H2,1-4H3,(H,24,27)/p+1/t21-/m1/s1 |
| InChIKey | BADXHSBLHHZKPH-OAQYLSRUSA-O |
| XLogP | 2.22 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |