C16H24N3O4S+ — CID 8962122
ethyl 2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 8962122) has the molecular formula C16H24N3O4S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is ethyl 2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8962122 |
| Molecular Formula | C16H24N3O4S+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethyl 2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)C)sc1NC(=O)C[NH+]1CCNC(=O)C1 |
| InChI | InChI=1S/C16H23N3O4S/c1-4-23-16(22)11-7-12(10(2)3)24-15(11)18-14(21)9-19-6-5-17-13(20)8-19/h7,10H,4-6,8-9H2,1-3H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | KVSFICLQUSJFBC-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |