C18H25N3O3S2 — CID 8962170
4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2-methoxyethyl)-1,3-thiazol-2-amine (PubChem CID 8962170) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2-methoxyethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2-methoxyethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8962170 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[4-(azepan-1-ylsulfonyl)phenyl]-N-(2-methoxyethyl)-1,3-thiazol-2-amine |
| SMILES | COCCNc1nc(-c2ccc(S(=O)(=O)N3CCCCCC3)cc2)cs1 |
| InChI | InChI=1S/C18H25N3O3S2/c1-24-13-10-19-18-20-17(14-25-18)15-6-8-16(9-7-15)26(22,23)21-11-4-2-3-5-12-21/h6-9,14H,2-5,10-13H2,1H3,(H,19,20) |
| InChIKey | GKNCXGNEBVESAY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|