C14H17N3O2S2 — CID 1285323
4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine (PubChem CID 1285323) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1285323 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-(4-piperidin-1-ylsulfonylphenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(S(=O)(=O)N3CCCCC3)cc2)cs1 |
| InChI | InChI=1S/C14H17N3O2S2/c15-14-16-13(10-20-14)11-4-6-12(7-5-11)21(18,19)17-8-2-1-3-9-17/h4-7,10H,1-3,8-9H2,(H2,15,16) |
| InChIKey | DQTDKUCWHSNMAD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |