C17H18BrNO2S — CID 8963402
(E)-N-[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-3-(5-methylthiophen-2-yl)prop-2-enamide (PubChem CID 8963402) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-3-(5-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-3-(5-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8963402 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (E)-N-[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-3-(5-methylthiophen-2-yl)prop-2-enamide |
| SMILES | COc1ccc([C@H](C)NC(=O)/C=C/c2ccc(C)s2)cc1Br |
| InChI | InChI=1S/C17H18BrNO2S/c1-11-4-6-14(22-11)7-9-17(20)19-12(2)13-5-8-16(21-3)15(18)10-13/h4-10,12H,1-3H3,(H,19,20)/b9-7+/t12-/m0/s1 |
| InChIKey | AKZFMWYHPVVETQ-CRALRDPISA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|