C21H23FN2O3 — CID 8967264
(E)-3-(3,5-dimethoxyphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 8967264) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8967264 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-[4-(4-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(c3ccc(F)cc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H23FN2O3/c1-26-19-13-16(14-20(15-19)27-2)3-8-21(25)24-11-9-23(10-12-24)18-6-4-17(22)5-7-18/h3-8,13-15H,9-12H2,1-2H3/b8-3+ |
| InChIKey | GMUHQNIMYNOQFJ-FPYGCLRLSA-N |
| XLogP | 3.20 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|