C19H23ClN2O6 — CID 8971427
[(2R)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 8971427) has the molecular formula C19H23ClN2O6 and a molecular weight of 410.85 g/mol. Its IUPAC name is [(2R)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [(2R)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 8971427 |
| Molecular Formula | C19H23ClN2O6 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2R)-1-(3-chloro-2-methylanilino)-1-oxopropan-2-yl] 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@@H](C)OC(=O)C[C@H]1C(=O)C[C@@H](C)[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C19H23ClN2O6/c1-10-7-17(23)13(14(10)9-22(26)27)8-18(24)28-12(3)19(25)21-16-6-4-5-15(20)11(16)2/h4-6,10,12-14H,7-9H2,1-3H3,(H,21,25)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | GLTXTLRWYGNGBJ-FMKGYKFTSA-N |
| XLogP | 3.03 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|